Compound Q&A

What are the physical and chemical properties of Fosbretabulin disodium (CAS: 168555-66-6)?

Answer

Fosbretabulin disodium
Fosbretabulin disodium (CAS: 168555-66-6) is a crystalline compound with a molecular weight of approximately 576.4 g/mol. It has a solubility of about 1 mg/mL in water. This compound is relatively stable under normal conditions but may react with strong acids or bases. It is used in the pharmaceutical industry for its anti-angiogenic properties.

About

English Name Fosbretabulin disodium
Molecular Formula C18H19Na2O8P
Molecular Weight 440.3 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey VXNQMUVMEIGUJW-XNOMRPDFSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Fosbretabulin disodium (CAS: 168555-66-6) typically synthesized?

Fosbretabulin disodium is typically synthesized through a multi-step process involving the conversio...

Compound Q&A

What industries use Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is primarily used in the pharmaceutical industry, specific...

Compound Q&A

What precautions should be taken when handling Fosbretabulin disodium (CAS: 168555-66-6)?

When handling Fosbretabulin disodium (CAS: 168555-66-6), wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...