Compound Q&A

What industries use Fosbretabulin disodium (CAS: 168555-66-6)?

Answer

Fosbretabulin disodium
Fosbretabulin disodium (CAS: 168555-66-6) is primarily used in the pharmaceutical industry, specifically for the development of anti-angiogenic drugs. It is also relevant in research and development for its potential applications in treating certain types of cancer and other vascular diseases.

About

English Name Fosbretabulin disodium
Molecular Formula C18H19Na2O8P
Molecular Weight 440.3 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey VXNQMUVMEIGUJW-XNOMRPDFSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Fosbretabulin disodium (CAS: 168555-66-6) typically synthesized?

Fosbretabulin disodium is typically synthesized through a multi-step process involving the conversio...

Compound Q&A

What precautions should be taken when handling Fosbretabulin disodium (CAS: 168555-66-6)?

When handling Fosbretabulin disodium (CAS: 168555-66-6), wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...