Compound Q&A

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

Answer

Indacaterol maleate
When handling Indacaterol maleate (CAS: 753498-25-8), proper personal protective equipment (PPE) such as gloves and safety goggles should be worn. The compound should be stored in a cool, dry place away from direct sunlight. In case of a spill, it should be cleaned up using appropriate absorbent materials and the area should be ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name Indacaterol maleate
Molecular Formula C28H32N2O7
Molecular Weight 508.5629 g/mol
SMILES CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O
InChIKey IREJFXIHXRZFER-PCBAQXHCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

Indacaterol maleate is synthesized through a multi-step process involving the formation of the indac...

Compound Q&A

What industries use Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is primarily used in the pharmaceutical industry for the trea...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...