Compound Q&A

What industries use Indacaterol maleate (CAS: 753498-25-8)?

Answer

Indacaterol maleate
Indacaterol maleate (CAS: 753498-25-8) is primarily used in the pharmaceutical industry for the treatment of chronic obstructive pulmonary disease (COPD). It is also of interest in the research and development of new drug formulations for respiratory disorders.

About

English Name Indacaterol maleate
Molecular Formula C28H32N2O7
Molecular Weight 508.5629 g/mol
SMILES CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O
InChIKey IREJFXIHXRZFER-PCBAQXHCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

Indacaterol maleate is synthesized through a multi-step process involving the formation of the indac...

Compound Q&A

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

When handling Indacaterol maleate (CAS: 753498-25-8), proper personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...