Compound Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

Answer

Indacaterol maleate
Indacaterol maleate is synthesized through a multi-step process involving the formation of the indacaterol intermediate followed by maleic anhydride addition. The reaction is performed under mild conditions with high selectivity, yielding a final product with a high purity grade of over 98%.

About

English Name Indacaterol maleate
Molecular Formula C28H32N2O7
Molecular Weight 508.5629 g/mol
SMILES CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O
InChIKey IREJFXIHXRZFER-PCBAQXHCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is primarily used in the pharmaceutical industry for the trea...

Compound Q&A

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

When handling Indacaterol maleate (CAS: 753498-25-8), proper personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...