Compound Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

Answer

Indacaterol maleate
Indacaterol maleate is synthesized through a multi-step process involving the formation of the indacaterol intermediate followed by maleic anhydride addition. The reaction is performed under mild conditions with high selectivity, yielding a final product with a high purity grade of over 98%.

About

English Name Indacaterol maleate
Molecular Formula C28H32N2O7
Molecular Weight 508.56 g/mol
SMILES CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O
InChIKey IREJFXIHXRZFER-PCBAQXHCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is primarily used in the pharmaceutical industry for the trea...

Compound Q&A

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

When handling Indacaterol maleate (CAS: 753498-25-8), proper personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...