Compound Q&A

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Answer

Indacaterol maleate (CAS: 753498-25-8) is a crystalline compound with a molecular weight of approximately 414.5 g/mol. It has a low aqueous solubility but good solubility in organic solvents. Chemically, it is highly stable and exhibits low reactivity under normal conditions, making it suitable for pharmaceutical applications.

About

CAS No 753498-25-8

English Name Indacaterol maleate

Molecular Formula C28H32N2O7

Molecular Weight 508.5629 g/mol

SMILES CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O

InChIKey IREJFXIHXRZFER-PCBAQXHCSA-N

Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

Indacaterol maleate is synthesized through a multi-step process involving the formation of the indac...

Compound Q&A

What industries use Indacaterol maleate (CAS: 753498-25-8)?

Indacaterol maleate (CAS: 753498-25-8) is primarily used in the pharmaceutical industry for the trea...

Compound Q&A

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

When handling Indacaterol maleate (CAS: 753498-25-8), proper personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What are the physical and chemical properties of Indacaterol maleate (CAS: 753498-25-8)?

Answer

About

Related Q&A

How is Indacaterol maleate (CAS: 753498-25-8) typically synthesized?

What industries use Indacaterol maleate (CAS: 753498-25-8)?

What precautions should be taken when handling Indacaterol maleate (CAS: 753498-25-8)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Mofu Medicine Technology Co., Ltd.

ShangHaiYiJi Industrial Co Ltd

MedChemExpress LLC

ShangHaiMaiRuiErShengHua Technology Co Ltd

Hangzhou Yaorieyicheng Biopharmaceutical Co., Ltd.

Nanjing Pusenheng Biopharm Technology Co., Ltd.