Compound Q&A

How should Pantoprazole EP Impurity B (CAS: 102625-64-9) be stored?

Answer

Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Pantoprazole EP Impurity B (CAS: 102625-64-9) should be stored in a sealed, light-resistant container at controlled room temperature (15-30°C) or refrigerated conditions (2-8°C) to maintain stability. It is sensitive to moisture and light, so desiccation and protection from humidity are essential. Storage should comply with chemical safety regulations to prevent degradation or contamination.

About

English Name Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Molecular Formula C16H15F2N3O3S
Molecular Weight 367.37700000000007 g/mol
SMILES COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)OC(F)F)OC
InChIKey UKILEIRWOYBGEJ-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is a sulfide derivative of pantoprazole, a proton pump...

Compound Q&A

What are the main uses of Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is primarily used in pharmaceutical research and quali...

Compound Q&A

Is Pantoprazole EP Impurity B (CAS: 102625-64-9) safe?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is generally considered safe when handled according to...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...