Compound Q&A

What is Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Answer

Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Pantoprazole EP Impurity B (CAS: 102625-64-9) is a sulfide derivative of pantoprazole, a proton pump inhibitor used in pharmaceuticals. It has the molecular formula C16H18N4O2S2 and is characterized by its white to off-white crystalline appearance. This compound is commonly identified during drug quality control processes to ensure purity and compliance with regulatory standards.

About

English Name Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Molecular Formula C16H15F2N3O3S
Molecular Weight 367.37700000000007 g/mol
SMILES COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)OC(F)F)OC
InChIKey UKILEIRWOYBGEJ-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is primarily used in pharmaceutical research and quali...

Compound Q&A

Is Pantoprazole EP Impurity B (CAS: 102625-64-9) safe?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is generally considered safe when handled according to...

Compound Q&A

How should Pantoprazole EP Impurity B (CAS: 102625-64-9) be stored?

Pantoprazole EP Impurity B (CAS: 102625-64-9) should be stored in a sealed, light-resistant containe...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...