Compound Q&A

What is Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Answer

Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Pantoprazole EP Impurity B (CAS: 102625-64-9) is a sulfide derivative of pantoprazole, a proton pump inhibitor used in pharmaceuticals. It has the molecular formula C16H18N4O2S2 and is characterized by its white to off-white crystalline appearance. This compound is commonly identified during drug quality control processes to ensure purity and compliance with regulatory standards.

About

English Name Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Molecular Formula C16H15F2N3O3S
Molecular Weight 367.38 g/mol
SMILES COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)OC(F)F)OC
InChIKey UKILEIRWOYBGEJ-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is primarily used in pharmaceutical research and quali...

Compound Q&A

Is Pantoprazole EP Impurity B (CAS: 102625-64-9) safe?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is generally considered safe when handled according to...

Compound Q&A

How should Pantoprazole EP Impurity B (CAS: 102625-64-9) be stored?

Pantoprazole EP Impurity B (CAS: 102625-64-9) should be stored in a sealed, light-resistant containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...