Compound Q&A

Is Pantoprazole EP Impurity B (CAS: 102625-64-9) safe?

Answer

Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Pantoprazole EP Impurity B (CAS: 102625-64-9) is generally considered safe when handled according to standard laboratory protocols, but it requires caution. Limited toxicity data suggests it is less hazardous than the parent compound, but proper protective measures such as gloves and ventilation should be used. Safety standards under ICH guidelines emphasize monitoring its levels in drug products to ensure they remain within acceptable thresholds.

About

English Name Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Molecular Formula C16H15F2N3O3S
Molecular Weight 367.38 g/mol
SMILES COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)OC(F)F)OC
InChIKey UKILEIRWOYBGEJ-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is a sulfide derivative of pantoprazole, a proton pump...

Compound Q&A

What are the main uses of Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is primarily used in pharmaceutical research and quali...

Compound Q&A

How should Pantoprazole EP Impurity B (CAS: 102625-64-9) be stored?

Pantoprazole EP Impurity B (CAS: 102625-64-9) should be stored in a sealed, light-resistant containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...