Compound Q&A

What are the main uses of Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Answer

Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Pantoprazole EP Impurity B (CAS: 102625-64-9) is primarily used in pharmaceutical research and quality control to detect and quantify impurities in pantoprazole formulations. It may also serve as a degradation product or byproduct in drug manufacturing. Its presence is critical for assessing the safety and efficacy of pharmaceutical products, particularly in adherence to USP and EP specifications.

About

English Name Pantoprazole EP Impurity B (Pantoprazole USP Related Compound B, Pantoprazole Sulfide)
Molecular Formula C16H15F2N3O3S
Molecular Weight 367.38 g/mol
SMILES COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)OC(F)F)OC
InChIKey UKILEIRWOYBGEJ-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is Pantoprazole EP Impurity B (CAS: 102625-64-9)?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is a sulfide derivative of pantoprazole, a proton pump...

Compound Q&A

Is Pantoprazole EP Impurity B (CAS: 102625-64-9) safe?

Pantoprazole EP Impurity B (CAS: 102625-64-9) is generally considered safe when handled according to...

Compound Q&A

How should Pantoprazole EP Impurity B (CAS: 102625-64-9) be stored?

Pantoprazole EP Impurity B (CAS: 102625-64-9) should be stored in a sealed, light-resistant containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...