Compound Q&A

How should Avibactam sodium (CAS: 1192491-61-4) be stored?

Answer

Avibactam sodium
Avibactam sodium (CAS: 1192491-61-4) should be stored at controlled room temperature (2-8°C) in a dry, light-protected environment. It is typically kept in sealed, airtight containers to maintain stability and prevent degradation. Avoid exposure to moisture, direct sunlight, and extreme temperatures to ensure optimal shelf life and efficacy.

About

English Name Avibactam sodium
Molecular Formula C7H10N3NaO6S
Molecular Weight 287.23 g/mol
SMILES C1CC(N2CC1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+]
InChIKey RTCIKUMODPANKX-JBUOLDKXSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Avibactam sodium (CAS: 1192491-61-4)?

Avibactam sodium (CAS: 1192491-61-4) is a beta-lactamase inhibitor used in combination with beta-lac...

Compound Q&A

What are the main uses of Avibactam sodium (CAS: 1192491-61-4)?

Avibactam sodium (CAS: 1192491-61-4) is primarily used in pharmaceuticals as a synergistic agent wit...

Compound Q&A

Is Avibactam sodium (CAS: 1192491-61-4) safe?

Avibactam sodium (CAS: 1192491-61-4) is considered safe when used as directed in medical treatments....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...