Compound Q&A

What are the main uses of Avibactam sodium (CAS: 1192491-61-4)?

Answer

Avibactam sodium
Avibactam sodium (CAS: 1192491-61-4) is primarily used in pharmaceuticals as a synergistic agent with antibiotics like ceftazidime and cefepime. It targets Gram-negative bacteria resistant to beta-lactam antibiotics, aiding in treating severe infections such as pneumonia and urinary tract infections. Additionally, it plays a role in research for developing new antimicrobial strategies against drug-resistant pathogens.

About

English Name Avibactam sodium
Molecular Formula C7H10N3NaO6S
Molecular Weight 287.23 g/mol
SMILES C1CC(N2CC1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+]
InChIKey RTCIKUMODPANKX-JBUOLDKXSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Avibactam sodium (CAS: 1192491-61-4)?

Avibactam sodium (CAS: 1192491-61-4) is a beta-lactamase inhibitor used in combination with beta-lac...

Compound Q&A

Is Avibactam sodium (CAS: 1192491-61-4) safe?

Avibactam sodium (CAS: 1192491-61-4) is considered safe when used as directed in medical treatments....

Compound Q&A

How should Avibactam sodium (CAS: 1192491-61-4) be stored?

Avibactam sodium (CAS: 1192491-61-4) should be stored at controlled room temperature (2-8°C) in a dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...