Compound Q&A

What is Avibactam sodium (CAS: 1192491-61-4)?

Answer

Avibactam sodium
Avibactam sodium (CAS: 1192491-61-4) is a beta-lactamase inhibitor used in combination with beta-lactam antibiotics to combat drug-resistant bacterial infections. Its chemical formula is C18H23N5O6S2, and it exhibits stability in aqueous solutions. Avibactam sodium is characterized by its ability to enhance the efficacy of antibiotics by preventing bacterial enzymes from degrading them, making it a critical component in modern antimicrobial therapies.

About

English Name Avibactam sodium
Molecular Formula C7H10N3NaO6S
Molecular Weight 287.23 g/mol
SMILES C1CC(N2CC1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+]
InChIKey RTCIKUMODPANKX-JBUOLDKXSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Avibactam sodium (CAS: 1192491-61-4)?

Avibactam sodium (CAS: 1192491-61-4) is primarily used in pharmaceuticals as a synergistic agent wit...

Compound Q&A

Is Avibactam sodium (CAS: 1192491-61-4) safe?

Avibactam sodium (CAS: 1192491-61-4) is considered safe when used as directed in medical treatments....

Compound Q&A

How should Avibactam sodium (CAS: 1192491-61-4) be stored?

Avibactam sodium (CAS: 1192491-61-4) should be stored at controlled room temperature (2-8°C) in a dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...