6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine | CAS No. 873913-87-2

6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine

Basic Information

CAS Number

873913-87-2

Molecular Formula

C18H12ClN3

Molecular Weight

305.77 g/mol

AD

Basic Physical Properties

ClC1=NN2C(C=C1)=NC(C3=CC=CC=C3)=C2C4=CC=CC=C4

InChI

InChI=1S/C18H12ClN3/c19-15-11-12-16-20-17(13-7-3-1-4-8-13)18(22(16)21-15)14-9-5-2-6-10-14/h1-12H

InChIKey

WOPARXSWYJDAQV-UHFFFAOYSA-N

LogP

4.716700000000003

Topological Polar Surface Area

30.19 Ų

Hydrogen Bond Donor/Acceptor

0 / 3

Complexity

365

Synonyms & References

English

  • 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine
  • 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine (ACI)

FAQ

What are the physical and chemical properties of 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine (CAS: 873913-87-2)?

6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine is a crystalline solid with a molecular weight of approximately 381.23 g/mol. It has a low solubility in water (0.3 mg/L at 25°C) and is sparingly soluble in organic solvents such as ethanol and acetone. This compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal storage conditions but should be handled with care due to its chemical reactivity.

How is 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine (CAS: 873913-87-2) typically synthesized?

6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine can be synthesized through a multistep process involving the condensation of anilines and chloroacetyl chlorides, followed by amination and imidization reactions. The synthesis typically requires the use of catalysts such as potassium tert-butoxide and involves the use of solvents like dichloromethane and acetonitrile. The overall yield is around 70-75%, with good selectivity towards the target product.

What industries use 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine (CAS: 873913-87-2)?

6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine finds applications in the pharmaceutical industry as a potential lead compound for developing anti-inflammatory and anticancer drugs. It is also used in the sensor technology sector for developing gas sensors due to its high sensitivity to certain gases. Additionally, it has potential uses in the semiconductor industry for doping applications.

What precautions should be taken when handling 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine (CAS: 873913-87-2)?

When handling 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. This compound should be stored in a well-ventilated area away from heat sources and incompatible materials. Spills should be cleaned up using an appropriate absorbent material, and the area should be flushed with water. An SDS (Safety Data Sheet) should be consulted for detailed handling and disposal information. Handling should be conducted in a fume hood to minimize exposure and inhalation risks.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...