3-Bromo-4-pyridinethiol | CAS No. 82264-72-0

3-Bromo-4-pyridinethiol

Basic Information

CAS Number

82264-72-0

Molecular Formula

C5H4BrNS

Molecular Weight

190.07 g/mol

AD

Basic Physical Properties

c1cncc(c1S)Br

InChI

InChI=1S/C5H4BrNS/c6-4-3-7-2-1-5(4)8/h1-3H,(H,7,8)

InChIKey

JXMSCHXZXYCDEM-UHFFFAOYSA-N

LogP

2.1328

Topological Polar Surface Area

12.89 Ų

Hydrogen Bond Donor/Acceptor

0 / 1

Complexity

171

Synonyms & References

English

  • 3-Bromopyridine-4-thiol
  • 4-Pyridinethiol, 3-bromo-
  • 3-Bromo-4-mercaptopyridine
  • 3-bromo-1H-pyridine-4-thione
  • 4(1H)-Pyridinethione, 3-bromo-
  • AMY38896
  • SY031436

MDL Number

MFCD28337455

FAQ

What are the physical and chemical properties of 3-Bromo-4-pyridinethiol (CAS: 82264-72-0)?

3-Bromo-4-pyridinethiol (CAS: 82264-72-0) is a crystalline solid with a molecular weight of approximately 196.02 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is moderately reactive and undergoes substitution reactions. It has a characteristic odor and is sensitive to heat and light.

How is 3-Bromo-4-pyridinethiol (CAS: 82264-72-0) typically synthesized?

3-Bromo-4-pyridinethiol can be synthesized by the reaction of 4-pyridinethiol with bromine in the presence of a suitable solvent. Common solvents include dichloromethane or ethanol. The reaction is carried out at room temperature, and the use of a catalyst such as iron(III) chloride can improve the yield and selectivity. The overall reaction is highly exothermic and requires careful handling to prevent the formation of unwanted by-products.

What industries use 3-Bromo-4-pyridinethiol (CAS: 82264-72-0)?

3-Bromo-4-pyridinethiol (CAS: 82264-72-0) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involving sulfur-containing functionalities. It is also utilized in the production of sensors for detecting various gases and in the development of organic semiconductors for electronic devices. Additionally, it plays a role in the manufacturing of some polymers with specific chemical properties.

What precautions should be taken when handling 3-Bromo-4-pyridinethiol (CAS: 82264-72-0)?

When handling 3-Bromo-4-pyridinethiol (CAS: 82264-72-0), it is essential to use personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be stored in a cool, dry place away from sources of heat and light. Working with it should be done in a fume hood to minimize inhalation risks. In case of a spill, it is recommended to use appropriate absorbent materials and dispose of them according to local regulations. Always refer to the safety data sheet (SDS) for specific handling and disposal instructions.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...