Sitagliptin impurity 83 | CAS No. 2248445-00-1

Sitagliptin impurity 83

Basic Information

CAS Number

2248445-00-1

Molecular Formula

C14H14F3NO3

Molecular Weight

301.26 g/mol

AD

Basic Physical Properties

C1COCCN1C(CC(=O)CC1C=C(F)C(=CC=1F)F)=O

InChI

1S/C14H14F3NO3/c15-11-8-13(17)12(16)6-9(11)5-10(19)7-14(20)18-1-3-21-4-2-18/h6,8H,1-5,7H2

InChIKey

CWJFNGNEUPHUID-UHFFFAOYSA-N

LogP

1.4644000000000001

Topological Polar Surface Area

46.61 Ų

Hydrogen Bond Donor/Acceptor

0 / 4

Synonyms & References

English

    MDL Number

    MFCD33401696

    FAQ

    What regulatory guidelines apply to Sitagliptin impurity 83 (CAS: 2248445-00-1)?

    Sitagliptin impurity 83 (CAS: 2248445-00-1) is subject to various regulatory guidelines. In the European Union, it must comply with REACH regulations for registration, evaluation, authorization, and restriction of chemicals. In the U.S., the FDA and EPA have specific guidelines for the testing and handling of impurities in pharmaceuticals. GHS classification also applies, categorizing the compound based on its hazards. Proper documentation and adherence to these guidelines are essential for safe and legal use.

    Are there alternatives to Sitagliptin impurity 83 (CAS: 2248445-00-1) in synthesis?

    In the synthesis of sitagliptin, there are alternative reagents and methods that can be used to minimize the formation of impurities like Sitagliptin impurity 83 (CAS: 2248445-00-1). Common alternatives include using purer starting materials, optimizing reaction conditions, and employing chiral catalysts. These strategies can significantly reduce the presence of impurities and improve the overall yield and purity of the final product.

    What is the market or research trend for Sitagliptin impurity 83 (CAS: 2248445-00-1)?

    The market for Sitagliptin impurity 83 (CAS: 2248445-00-1) is closely tied to the development and production of sitagliptin-based medications. As research continues to explore sitagliptin's efficacy and potential for new applications, the need for high-quality impurity analysis and control will increase. Additionally, there is a growing focus on green chemistry and sustainable manufacturing processes, which may lead to new techniques for reducing impurities like Sitagliptin impurity 83 in the production of sitagliptin derivatives.

    How should waste containing Sitagliptin impurity 83 (CAS: 2248445-00-1) be handled?

    Handling waste containing Sitagliptin impurity 83 (CAS: 2248445-00-1) requires careful consideration of safety and environmental protection. Waste liquid should be collected in appropriate containers and stored in a secure, labeled area. For disposal, incineration is a common method, but professional waste disposal services should be used to ensure compliance with local regulations. Additionally, environmental precautions such as preventing leakage and ensuring proper ventilation should be maintained throughout the handling and disposal process to protect both human health and the environment.

    You might also like

    Compound Q&A

    What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

    6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

    21889-89-46-Methyl-7-oxabicycl...
    Compound Q&A

    What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

    4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

    906353-00-24-[(6-Methyl-2-pyraz...
    Compound Q&A

    What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

    2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

    49745-42-82-(2-Pyridinyl)-1,3-...
    Compound Q&A

    What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

    2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

    24783-42-42-(6-Chloro-2-pyridi...
    Compound Q&A

    What is 2-Oxopropanamide (CAS: 631-66-3)?

    2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

    631-66-32-Oxopropanamide
    Compound Q&A

    What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

    2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

    1289040-88-52-Methyl-2-propanyl ...
    Compound Q&A

    What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

    NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

    2241019-57-6NAMPT inhibitor-link...
    Compound Q&A

    What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

    It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

    1310404-58-0(2-(2,2,2-Trifluoroa...
    Compound Q&A

    What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

    1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

    794568-90-41-(2-Chlorophenyl)-6...
    Compound Q&A

    What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

    Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

    1314981-48-0Vinyl(chloromethyl)d...