Compound Q&A

Are there alternatives to Sitagliptin impurity 83 (CAS: 2248445-00-1) in synthesis?

Answer

Sitagliptin impurity 83
In the synthesis of sitagliptin, there are alternative reagents and methods that can be used to minimize the formation of impurities like Sitagliptin impurity 83 (CAS: 2248445-00-1). Common alternatives include using purer starting materials, optimizing reaction conditions, and employing chiral catalysts. These strategies can significantly reduce the presence of impurities and improve the overall yield and purity of the final product.

About

English Name Sitagliptin impurity 83
Molecular Formula C14H14F3NO3
Molecular Weight 301.26 g/mol
SMILES C1COCCN1C(CC(=O)CC1C=C(F)C(=CC=1F)F)=O
InChIKey CWJFNGNEUPHUID-UHFFFAOYSA-N
Last Updated: 2026-03-30 12:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to Sitagliptin impurity 83 (CAS: 2248445-00-1)?

Sitagliptin impurity 83 (CAS: 2248445-00-1) is subject to various regulatory guidelines. In the Euro...

Compound Q&A

What is the market or research trend for Sitagliptin impurity 83 (CAS: 2248445-00-1)?

The market for Sitagliptin impurity 83 (CAS: 2248445-00-1) is closely tied to the development and pr...

Compound Q&A

How should waste containing Sitagliptin impurity 83 (CAS: 2248445-00-1) be handled?

Handling waste containing Sitagliptin impurity 83 (CAS: 2248445-00-1) requires careful consideration...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...