N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine | CAS No. 1502829-45-9

N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine

Basic Information

CAS Number

1502829-45-9

Molecular Formula

C29H37ClFN5O4

Molecular Weight

574.1 g/mol

AD

Basic Physical Properties

COC1C=C2N=CN=C(C2=CC=1OCCCN1CCOCC1)N(CCCN1CCOCC1)C1=CC(Cl)=C(F)C=C1

InChI

InChI=1S/C29H37ClFN5O4/c1-37-27-20-26-23(19-28(27)40-13-3-7-35-11-16-39-17-12-35)29(33-21-32-26)36(22-4-5-25(31)24(30)18-22)8-2-6-34-9-14-38-15-10-34/h4-5,18-21H,2-3,6-17H2,1H3

InChIKey

MCDVSKSUNKYMRM-UHFFFAOYSA-N

LogP

4.392400000000004

Topological Polar Surface Area

72.42000000000002 Ų

Hydrogen Bond Donor/Acceptor

0 / 9

Synonyms & References

English

  • Gefitinib Impurity P
  • N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholinopropoxy)-N-(3-morpholinopropyl)quinazolin-4-amine

FAQ

What is N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine (CAS: 1502829-45-9)?

N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine is a complex organic compound with a quinazoline backbone and additional substituents. This chemical has a unique structure that makes it suitable for pharmaceutical applications, particularly as an intermediate in the synthesis of drugs. It contains functional groups such as amine, morpholine, and phenyl rings, contributing to its versatile chemical properties.

What are the main uses of N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine (CAS: 1502829-45-9)?

The main use of N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine is as an intermediate in the pharmaceutical industry. It plays a crucial role in the development of new drugs, particularly those targeting specific biological pathways. This compound is also used in research for its unique structural features, which allow for the study of various chemical reactions and interactions.

Is N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine (CAS: 1502829-45-9) safe?

N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine is safe under proper handling and storage conditions. However, it is important to follow all safety guidelines and use appropriate protective equipment, such as gloves and goggles, when handling this compound. Ensure good ventilation and avoid contact with skin and eyes. Storage should be in a cool, dry place away from direct sunlight and heat sources.

How should N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine (CAS: 1502829-45-9) be stored?

N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-morpholinyl)propoxy]-N-[3-(4-morpholinyl)propyl]-4-quinazolinamine should be stored in a cool, dry place away from direct sunlight and heat sources. Maintain a temperature range of 15°C to 25°C (59°F to 77°F) to prevent degradation. Store in a tightly closed container to protect from moisture and light. It is recommended to use a reagent bottle or a suitable storage container to ensure the stability of the compound during storage.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...