4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole | CAS No. 1257633-67-2

4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole

Basic Information

CAS Number

1257633-67-2

Molecular Formula

C11H21N3O2

Molecular Weight

227.31 g/mol

AD

Basic Physical Properties

Boiling Point

290.2±48.0 ºC (760 Torr),

Flash Point

129.3±29.6 ºC,

CCOC(c1cn(nn1)C(C)(C)C)OCC

InChI

InChI=1S/C11H21N3O2/c1-6-15-10(16-7-2)9-8-14(13-12-9)11(3,4)5/h8,10H,6-7H2,1-5H3

InChIKey

TYSFPRWYDKUYEU-UHFFFAOYSA-N

LogP

2.1047000000000002

Topological Polar Surface Area

49.17 Ų

Hydrogen Bond Donor/Acceptor

0 / 5

Synonyms & References

English

  • 1-tert-Butyl-4-diethoxymethyl-1H-[1,2,3]triazole

MDL Number

MFCD25957226

FAQ

What are the physical and chemical properties of 4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole (CAS: 1257633-67-2)?

4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole is a colorless to white crystalline solid with a molecular weight of approximately 292.29 g/mol. It has a low water solubility but is soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but may react with strong acids and bases. It shows good reactivity towards nucleophiles and electrophiles.

How is 4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole (CAS: 1257633-67-2) typically synthesized?

4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole is typically synthesized via a multistep process involving the reaction of 2-methyl-2-propanol with diethyl chloromethyl ether followed by substitution with a triazole derivative. This synthesis involves the use of a catalyst and typically results in a yield of around 70-80%. The reaction conditions are carefully controlled to ensure the desired product formation.

What industries use 4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole (CAS: 1257633-67-2)?

4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole is primarily used in pharmaceuticals for its potential as an antifungal and antiviral agent. It is also utilized in the synthesis of other complex organic molecules and as a precursor in the polymer industry for the development of new materials. Additionally, it has applications in the semiconductor industry as a dopant material.

What precautions should be taken when handling 4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole (CAS: 1257633-67-2)?

When handling 4-(Diethoxymethyl)-1-(2-methyl-2-propanyl)-1H-1,2,3-triazole, it is important to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from heat and open flames. It should be used in a well-ventilated area or a fume hood to avoid inhalation. In case of spill, immediately clean up using appropriate absorbent materials and consult a safety data sheet (SDS) for detailed instructions.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...