(3,5-Diiodo-2-methoxyphenyl)boronic acid | CAS No. 1072951-59-7

(3,5-Diiodo-2-methoxyphenyl)boronic acid

Basic Information

CAS Number

1072951-59-7

Molecular Formula

C7H7BI2O3

Molecular Weight

403.75 g/mol

AD

Basic Physical Properties

Melting Point

140-144 °C (dec.)

COc1c(I)cc(cc1B(O)O)I

InChI

InChI=1S/C7H7BI2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3,11-12H,1H3

InChIKey

GLXUCKYNVDXHBW-UHFFFAOYSA-N

LogP

0.5842

Topological Polar Surface Area

49.69 Ų

Hydrogen Bond Donor/Acceptor

2 / 3

Safety Information

View Safety Information

Hazard Statement

H315 Causes skin irritation
Skin corrosion/irritation
H319 Causes serious eye irritation
Serious eye damage/eye irritation
H335 May cause respiratory irritation
Specific target organ toxicity, single exposure; Respiratory tract irritation

Synonyms & References

English

  • (3,5-Diiodo-2-methoxyphenyl)boronic acid
  • 3,5-Diiodo-2-methoxyphenylboronic acid

MDL Number

MFCD08457647

Customs Code

2931900090

FAQ

What are the physical and chemical properties of (3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7)?

(3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7) is a solid, crystalline compound with a molecular weight of approximately 420.06 g/mol. It has low water solubility, making it poorly soluble in water but more soluble in organic solvents. This compound is highly reactive due to the presence of the iodo and methoxy groups, which can participate in various chemical reactions such as electrophilic aromatic substitution and nucleophilic addition reactions.

How is (3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7) typically synthesized?

(3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7) is usually synthesized through a multistep process involving the formation of an iodo derivative from 2-methoxyphenol and subsequent boronation using a borate ester under the influence of a base. The reaction typically requires a mild base to promote the boronation step, and the overall yield can range from moderate to good, depending on the purity of the starting materials and the reaction conditions.

What industries use (3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7)?

(3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7) finds applications in various industries, particularly in pharmaceuticals, where it is used as an intermediate in the synthesis of bioactive compounds. It is also utilized in polymer science for the development of novel materials, and in analytical chemistry as a reagent for sensor technologies and semiconductor manufacturing processes.

What precautions should be taken when handling (3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7)?

When handling (3,5-Diiodo-2-methoxyphenyl)boronic acid (CAS: 1072951-59-7), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a laboratory coat. This compound should be handled in a well-ventilated area or a fume hood due to its potential to release volatile components. Spills should be handled carefully to prevent skin contact and inhalation. In case of skin contact, immediately rinse with copious amounts of water. For more detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS) for (3,5-Diiodo-2-methoxyphenyl)boronic acid.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...