Compound Q&A

What industries use 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

Answer

5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde
5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde is used in the pharmaceutical industry for the synthesis of certain drug molecules due to its functional groups, which can be further modified to introduce various pharmacophores. It also finds applications in the polymer industry for the development of functional polymers and in the semiconductor industry for the production of organic electronic materials.

About

English Name 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde
Molecular Formula C13H19FO2Si
Molecular Weight 254.38 g/mol
SMILES CC(C)(C)[Si](C)(C)Oc1ccc(c(c1)C=O)F
InChIKey LCRGCKGCZUAUDG-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde is a crystalline solid with a molec...

Compound Q&A

How is 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1) typically synthesized?

5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde is typically synthesized through a ...

Compound Q&A

What precautions should be taken when handling 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

When handling 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde, it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...