Compound Q&A

How is 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1) typically synthesized?

Answer

5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde
5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde is typically synthesized through a silylation reaction of 2-fluorobenzaldehyde with dimethyl(2-methyl-2-propanyl)silyl chloride in the presence of a base such as imidazole. The reaction is carried out under anhydrous conditions to avoid hydrolysis. The yield is generally high, and the product shows good selectivity towards the desired silyl ether functionality.

About

English Name 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde
Molecular Formula C13H19FO2Si
Molecular Weight 254.38 g/mol
SMILES CC(C)(C)[Si](C)(C)Oc1ccc(c(c1)C=O)F
InChIKey LCRGCKGCZUAUDG-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

5-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-fluorobenzaldehyde is a crystalline solid with a molec...

Compound Q&A

What industries use 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde is used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde (CAS: 113984-67-1)?

When handling 5-{[Dimethyl(2-methyl-2-proanyl)silyl]oxy}-2-fluorobenzaldehyde, it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...