Compound Q&A

What precautions should be taken when handling (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

Answer

(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride
When handling this compound, use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood to avoid inhalation or skin contact. Spills should be handled with care using absorbent materials, and the area should be flushed with water. Refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 85541-57-7
English Name (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride
Molecular Formula C20H16F6O5
Molecular Weight 450.331 g/mol
SMILES COC(C1=CC=CC=C1)(C(=O)OC(=O)C(C2=CC=CC=C2)(C(F)(F)F)OC)C(F)(F)F
InChIKey AATFPUCRBIXXID-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

The compound is an anhydride with a crystalline form. Its molecular weight is approximately 295.25 g...

Compound Q&A

How is (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7) typically synthesized?

This compound is typically synthesized through the condensation of alpha-methoxy-alpha-(trifluoromet...

Compound Q&A

What industries use (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

This compound is used in the pharmaceutical industry for the synthesis of pharmaceutical intermediat...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...