Compound Q&A

What are the physical and chemical properties of (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

Answer

(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride
The compound is an anhydride with a crystalline form. Its molecular weight is approximately 295.25 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is reactive, particularly in esterification and amidation reactions. It is stable under normal conditions but requires handling with care due to its reactivity.

About

CAS No 85541-57-7
English Name (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride
Molecular Formula C20H16F6O5
Molecular Weight 450.33 g/mol
SMILES COC(C1=CC=CC=C1)(C(=O)OC(=O)C(C2=CC=CC=C2)(C(F)(F)F)OC)C(F)(F)F
InChIKey AATFPUCRBIXXID-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

How is (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7) typically synthesized?

This compound is typically synthesized through the condensation of alpha-methoxy-alpha-(trifluoromet...

Compound Q&A

What industries use (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

This compound is used in the pharmaceutical industry for the synthesis of pharmaceutical intermediat...

Compound Q&A

What precautions should be taken when handling (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Anhydride (CAS: 85541-57-7)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...