Compound Q&A

What industries use 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

Answer

4,6-Dichloroquinoline-3-carbonitrile
4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is used in the pharmaceutical industry for the synthesis of certain intermediates and active pharmaceutical ingredients. It is also utilized in the polymer industry for the modification of polymer properties and in the development of sensors for detecting certain chemical species. Additionally, it has applications in the semiconductor industry as a dopant.

About

English Name 4,6-Dichloroquinoline-3-carbonitrile
Molecular Formula C10H4Cl2N2
Molecular Weight 223.0582 g/mol
SMILES C1=CC2=NC=C(C(=C2C=C1Cl)Cl)C#N
InChIKey JTWDDTWMLBDQNM-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is a crystalline solid with a molecular weig...

Compound Q&A

How is 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) typically synthesized?

4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is typically synthesized via electrophilic a...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

When handling 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3), it is essential to use person...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...