Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Answer

Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharmaceutical industry for the synthesis of certain drugs. It also has applications in the polymer industry for modifying properties of polymers. Additionally, it is used in the semiconductor industry for selective etching processes and in sensor technology due to its unique chemical properties.

About

English Name Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Molecular Formula C10H10BrFO2
Molecular Weight 261.09 g/mol
SMILES CCOC(=O)CC1=C(C=CC(=C1)F)Br
InChIKey VJIZBDVPORTFJC-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is a colorless to slightly yellow liquid...

Compound Q&A

How is Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) typically synthesized?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is typically synthesized via a brominati...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

When handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8), proper personal protectiv...

Compound Q&A

What industries use 4-(4-tert-Butylphenyl)-1H-pyrazol-3-amine (CAS: 1015845-73-4)?

4-(4-tert-Butylphenyl)-1H-pyrazol-3-amine finds applications in various industri...

1015845-73-44-(4-tert-Butylpheny...
Compound Q&A

What industries use H3TATAB (CAS: 63557-10-8)?

H3TATAB is used in the pharmaceutical industry for the synthesis of certain orga...

63557-10-8H3TATAB
Compound Q&A

What are the main uses of 1-Ethyl-3-fluorobenzene (CAS: 696-39-9)?

1-Ethyl-3-fluorobenzene (CAS: 696-39-9) is primarily used as a precursor in the ...

696-39-91-Ethyl-3-fluorobenz...
Compound Q&A

What are the main uses of 1-(tert-Butoxycarbonyl)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (CAS: 851484-94-1)?

1-(tert-Butoxycarbonyl)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid is prim...

851484-94-11-(tert-Butoxycarbon...