Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

Answer

4-Methyl-2-benzofuran-1,3-dione
4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through several methods, including the Claisen condensation of 4-methylbenzaldehyde and benzoic acid. Another common route involves the oxidation of 4-methyl-2-benzofuran using nitric acid or potassium permanganate. The yield and selectivity of these reactions are typically high, and appropriate catalysts can be used to improve the reaction efficiency.

About

CAS No 4792-30-7
English Name 4-Methyl-2-benzofuran-1,3-dione
Molecular Formula C9H6O3
Molecular Weight 162.14399999999998 g/mol
SMILES CC1=C2C(=CC=C1)C(=O)OC2=O
InChIKey TWWAWPHAOPTQEU-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is a crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is utilized in various industries, including pharma...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

When handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7), it is essential to use appropriate p...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...