Compound Q&A

What are the physical and chemical properties of 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

Answer

4,6-Dichloroquinoline-3-carbonitrile
4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is a crystalline solid with a molecular weight of approximately 263.02 g/mol. It has a low water solubility, around 0.015 g/L at 25°C. This compound is moderately reactive towards nucleophiles and exhibits good stability towards thermal decomposition. It is sparingly soluble in common organic solvents like ethanol and chloroform.

About

English Name 4,6-Dichloroquinoline-3-carbonitrile
Molecular Formula C10H4Cl2N2
Molecular Weight 223.0582 g/mol
SMILES C1=CC2=NC=C(C(=C2C=C1Cl)Cl)C#N
InChIKey JTWDDTWMLBDQNM-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

How is 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) typically synthesized?

4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is typically synthesized via electrophilic a...

Compound Q&A

What industries use 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3) is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3)?

When handling 4,6-Dichloroquinoline-3-carbonitrile (CAS: 936498-04-3), it is essential to use person...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...