Compound Q&A

What precautions should be taken when handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Answer

ethyl 2-(4-bromo-2-formylphenoxy)acetate
When handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. The compound should be stored in a fume hood to minimize exposure. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for specific handling and disposal guidelines.

About

CAS No 51336-47-1
English Name ethyl 2-(4-bromo-2-formylphenoxy)acetate
Molecular Formula C11H11BrO4
Molecular Weight 287.11 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)Br)C=O
InChIKey QHGFILIGTMBUGQ-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is a crystalline solid with a molecular w...

Compound Q&A

How is ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) typically synthesized?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate is typically synthesized by the condensation of ethyl 2-(4-...

Compound Q&A

What industries use ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is used in the pharmaceutical industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...