Compound Q&A

What industries use ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Answer

ethyl 2-(4-bromo-2-formylphenoxy)acetate
Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is used in the pharmaceutical industry for the synthesis of certain organic compounds and intermediates. It is also utilized in the polymer industry for the modification of polymers, and in the chemical sensing sector for the development of new sensing materials. Additionally, it has potential applications in the semiconductor industry as a dopant.

About

CAS No 51336-47-1
English Name ethyl 2-(4-bromo-2-formylphenoxy)acetate
Molecular Formula C11H11BrO4
Molecular Weight 287.11 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)Br)C=O
InChIKey QHGFILIGTMBUGQ-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is a crystalline solid with a molecular w...

Compound Q&A

How is ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) typically synthesized?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate is typically synthesized by the condensation of ethyl 2-(4-...

Compound Q&A

What precautions should be taken when handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

When handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...