Compound Q&A

What are the physical and chemical properties of ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Answer

ethyl 2-(4-bromo-2-formylphenoxy)acetate
Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is a crystalline solid with a molecular weight of approximately 349.96 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is highly reactive due to the presence of the formyl group and bromine substituent, making it prone to nucleophilic and electrophilic reactions.

About

CAS No 51336-47-1
English Name ethyl 2-(4-bromo-2-formylphenoxy)acetate
Molecular Formula C11H11BrO4
Molecular Weight 287.11 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)Br)C=O
InChIKey QHGFILIGTMBUGQ-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

How is ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) typically synthesized?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate is typically synthesized by the condensation of ethyl 2-(4-...

Compound Q&A

What industries use ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

Ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1)?

When handling ethyl 2-(4-bromo-2-formylphenoxy)acetate (CAS: 51336-47-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...