Compound Q&A

What industries use 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

Answer

4-bromo-N,N-diethyl-naphthalene-1-carboxamide
4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the development of various drugs and also finds applications in the synthesis of functional polymers. Additionally, due to its unique chemical properties, it may be utilized in sensor technologies and semiconductor manufacturing.

About

English Name 4-bromo-N,N-diethyl-naphthalene-1-carboxamide
Molecular Formula C15H16BrNO
Molecular Weight 306.203 g/mol
SMILES CCN(CC)C(=O)c1ccc(c2c1cccc2)Br
InChIKey FVXQMTWRIJFMFB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is a crystalline solid with a high...

Compound Q&A

How is 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) typically synthesized?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) can be synthesized via the acylati...

Compound Q&A

What precautions should be taken when handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

When handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2), it is important to ...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...