Compound Q&A

How is 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) typically synthesized?

Answer

4-bromo-N,N-diethyl-naphthalene-1-carboxamide
4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) can be synthesized via the acylation of 4-bromonaphtalene-1-carboxylic acid with diethylamine. This process typically involves using an appropriate base, such as sodium hydride, in an aprotic solvent like dimethylformamide (DMF). The reaction is usually carried out under inert conditions to ensure high yield and selectivity. The product is then purified using column chromatography.

About

English Name 4-bromo-N,N-diethyl-naphthalene-1-carboxamide
Molecular Formula C15H16BrNO
Molecular Weight 306.203 g/mol
SMILES CCN(CC)C(=O)c1ccc(c2c1cccc2)Br
InChIKey FVXQMTWRIJFMFB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is a crystalline solid with a high...

Compound Q&A

What industries use 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

When handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2), it is important to ...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...