Compound Q&A

What are the physical and chemical properties of 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

Answer

4-bromo-N,N-diethyl-naphthalene-1-carboxamide
4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is a crystalline solid with a high molecular weight. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, especially under basic conditions, making it suitable for various chemical transformations. It has a melting point of around 130-132°C and a density of approximately 1.25 g/cm³.

About

English Name 4-bromo-N,N-diethyl-naphthalene-1-carboxamide
Molecular Formula C15H16BrNO
Molecular Weight 306.203 g/mol
SMILES CCN(CC)C(=O)c1ccc(c2c1cccc2)Br
InChIKey FVXQMTWRIJFMFB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) typically synthesized?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) can be synthesized via the acylati...

Compound Q&A

What industries use 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

4-Bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2)?

When handling 4-bromo-N,N-diethyl-naphthalene-1-carboxamide (CAS: 1199773-48-2), it is important to ...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...