Compound Q&A

What industries use Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (CAS: 50-13-5)?

Answer

Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (1:1)
Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride finds applications in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the polymer industry for modifying properties of polymers and in the sensor industry for developing chemical sensors due to its reactivity and specific functional groups.

About

CAS No 50-13-5
English Name Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (1:1)
Molecular Formula C15H22ClNO2
Molecular Weight 283.8 g/mol
SMILES CCOC(=O)C1(CCN(CC1)C)C2=CC=CC=C2.Cl
InChIKey WCNLCIJMFAJCPX-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (CAS: 50-13-5)?

Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride is a white crystalline solid with a mo...

Compound Q&A

How is Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (CAS: 50-13-5) typically synthesized?

Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride is synthesized by reacting 1-methyl-4-...

Compound Q&A

What precautions should be taken when handling Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride (CAS: 50-13-5)?

When handling Ethyl 1-methyl-4-phenyl-4-piperidinecarboxylate hydrochloride, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...