Compound Q&A

What precautions should be taken when handling 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

Answer

3-Methoxy-2,4,6-trifluorobenzoic acid
When handling 3-Methoxy-2,4,6-trifluorobenzoic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be stored in a cool, well-ventilated area away from heat and sources of ignition. If a spill occurs, it should be contained and cleaned up using appropriate chemical spill cleanup procedures. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal guidelines.

About

English Name 3-Methoxy-2,4,6-trifluorobenzoic acid
Molecular Formula C8H5F3O3
Molecular Weight 206.12 g/mol
SMILES COC1=C(C=C(C(=C1F)C(=O)O)F)F
InChIKey HBJGDRQQDGUBGN-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1) typically synthesized?

3-Methoxy-2,4,6-trifluorobenzoic acid is typically synthesized via the Friedel-Crafts alkylation of ...

Compound Q&A

What industries use 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...