Compound Q&A

How is 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1) typically synthesized?

Answer

3-Methoxy-2,4,6-trifluorobenzoic acid
3-Methoxy-2,4,6-trifluorobenzoic acid is typically synthesized via the Friedel-Crafts alkylation of 2,4,6-trifluorobenzoic anhydride with methanol. This process requires strong Lewis acids like aluminum chloride as a catalyst. The reaction is carried out at low temperatures to achieve a good yield. The product is isolated by recrystallization from solvents like dichloromethane.

About

English Name 3-Methoxy-2,4,6-trifluorobenzoic acid
Molecular Formula C8H5F3O3
Molecular Weight 206.12 g/mol
SMILES COC1=C(C=C(C(=C1F)C(=O)O)F)F
InChIKey HBJGDRQQDGUBGN-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

When handling 3-Methoxy-2,4,6-trifluorobenzoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...