Compound Q&A

What are the physical and chemical properties of 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

Answer

3-Methoxy-2,4,6-trifluorobenzoic acid
3-Methoxy-2,4,6-trifluorobenzoic acid is a white crystalline solid with a molecular weight of approximately 230.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like acetone and dichloromethane. Chemically, it is relatively stable but can undergo typical carboxylic acid reactions. It exhibits high reactivity towards nucleophiles and is prone to condensation reactions.

About

English Name 3-Methoxy-2,4,6-trifluorobenzoic acid
Molecular Formula C8H5F3O3
Molecular Weight 206.12 g/mol
SMILES COC1=C(C=C(C(=C1F)C(=O)O)F)F
InChIKey HBJGDRQQDGUBGN-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1) typically synthesized?

3-Methoxy-2,4,6-trifluorobenzoic acid is typically synthesized via the Friedel-Crafts alkylation of ...

Compound Q&A

What industries use 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

When handling 3-Methoxy-2,4,6-trifluorobenzoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...