Compound Q&A

What industries use 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

Answer

3-Methoxy-2,4,6-trifluorobenzoic acid
3-Methoxy-2,4,6-trifluorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also employed in the polymer industry for functionalization and modification of polymer chains. Additionally, it finds applications in the electronics industry for its use in the development of semiconductors and sensors due to its unique chemical properties.

About

English Name 3-Methoxy-2,4,6-trifluorobenzoic acid
Molecular Formula C8H5F3O3
Molecular Weight 206.12 g/mol
SMILES COC1=C(C=C(C(=C1F)C(=O)O)F)F
InChIKey HBJGDRQQDGUBGN-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

3-Methoxy-2,4,6-trifluorobenzoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1) typically synthesized?

3-Methoxy-2,4,6-trifluorobenzoic acid is typically synthesized via the Friedel-Crafts alkylation of ...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-2,4,6-trifluorobenzoic acid (CAS: 886499-94-1)?

When handling 3-Methoxy-2,4,6-trifluorobenzoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...