Compound Q&A

What industries use 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

Answer

5-Bromo-2-methoxybenzylzinc chloride
5-Bromo-2-methoxybenzylzinc chloride is used in the pharmaceutical industry for the synthesis of various organic compounds, particularly in drug discovery and development. It is also employed in polymer science for the modification of polymers, and in semiconductor manufacturing for the production of certain organic semiconductors.

About

English Name 5-Bromo-2-methoxybenzylzinc chloride
Molecular Formula C8H8BrClOZn
Molecular Weight 300.9 g/mol
SMILES COC1=C(C=C(C=C1)Br)[CH2-].Cl[Zn+]
InChIKey RYJPUAHIDAORNN-UHFFFAOYSA-M
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

5-Bromo-2-methoxybenzylzinc chloride is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9) typically synthesized?

5-Bromo-2-methoxybenzylzinc chloride is typically synthesized by reacting 2-methoxybenzylzinc chlori...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

When handling 5-Bromo-2-methoxybenzylzinc chloride, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...