Compound Q&A

How is 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9) typically synthesized?

Answer

5-Bromo-2-methoxybenzylzinc chloride
5-Bromo-2-methoxybenzylzinc chloride is typically synthesized by reacting 2-methoxybenzylzinc chloride with bromine in the presence of a base like sodium hydroxide. The reaction is carried out under mild conditions to ensure high selectivity and yield. This method provides a reliable route to the compound with good reproducibility.

About

English Name 5-Bromo-2-methoxybenzylzinc chloride
Molecular Formula C8H8BrClOZn
Molecular Weight 300.9 g/mol
SMILES COC1=C(C=C(C=C1)Br)[CH2-].Cl[Zn+]
InChIKey RYJPUAHIDAORNN-UHFFFAOYSA-M
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

5-Bromo-2-methoxybenzylzinc chloride is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

5-Bromo-2-methoxybenzylzinc chloride is used in the pharmaceutical industry for the synthesis of var...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-methoxybenzylzinc chloride (CAS: 352530-35-9)?

When handling 5-Bromo-2-methoxybenzylzinc chloride, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...