Compound Q&A

What precautions should be taken when handling (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

Answer

(2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. The compound should be used in a well-ventilated area or with the use of a fume hood to prevent inhalation. Spills should be cleaned up using appropriate methods, and the Material Safety Data Sheet (MSDS) should be consulted for detailed handling and disposal procedures.

About

English Name (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
Molecular Formula C14H16F3NO4
Molecular Weight 319.276354789734 g/mol
SMILES FC(C1C=CC=CC=1[C@@H](C(=O)O)NC(=O)OC(C)(C)C)(F)F
InChIKey DHJLBUSFXBGSRT-JTQLQIEISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

The compound has a crystalline form and a molecular weight of approximately 433.12 g/mol. It is poor...

Compound Q&A

How is (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8) typically synthesized?

The compound is usually synthesized via a multistep process involving acylation and amidation reacti...

Compound Q&A

What industries use (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...