Compound Q&A

What industries use (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

Answer

(2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
This compound is primarily used in the pharmaceutical industry for its potential as a drug intermediate. It also finds applications in the polymer industry, where its unique chemical properties make it useful for developing new materials with specific functionalities. Additionally, it may be used in sensor technology and semiconductor manufacturing due to its chemical reactivity and stability.

About

English Name (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
Molecular Formula C14H16F3NO4
Molecular Weight 319.276354789734 g/mol
SMILES FC(C1C=CC=CC=1[C@@H](C(=O)O)NC(=O)OC(C)(C)C)(F)F
InChIKey DHJLBUSFXBGSRT-JTQLQIEISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

The compound has a crystalline form and a molecular weight of approximately 433.12 g/mol. It is poor...

Compound Q&A

How is (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8) typically synthesized?

The compound is usually synthesized via a multistep process involving acylation and amidation reacti...

Compound Q&A

What precautions should be taken when handling (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...