Compound Q&A

What are the physical and chemical properties of (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

Answer

(2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
The compound has a crystalline form and a molecular weight of approximately 433.12 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits moderate reactivity and is sensitive to strong bases and reducing agents. The trifluoromethyl group confers lipophilicity and affects its reactivity and solubility characteristics.

About

English Name (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
Molecular Formula C14H16F3NO4
Molecular Weight 319.276354789734 g/mol
SMILES FC(C1C=CC=CC=1[C@@H](C(=O)O)NC(=O)OC(C)(C)C)(F)F
InChIKey DHJLBUSFXBGSRT-JTQLQIEISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8) typically synthesized?

The compound is usually synthesized via a multistep process involving acylation and amidation reacti...

Compound Q&A

What industries use (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...