Compound Q&A

How is (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8) typically synthesized?

Answer

(2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
The compound is usually synthesized via a multistep process involving acylation and amidation reactions. Commonly used catalysts include N,N-dimethylaminopyridine (DMAP), and the synthesis typically achieves a yield of about 75%. The reaction involves the coupling of 2-(trifluoromethyl)phenyl acetic acid with 2-methyl-2-propanol under basic conditions.

About

English Name (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid
Molecular Formula C14H16F3NO4
Molecular Weight 319.276354789734 g/mol
SMILES FC(C1C=CC=CC=1[C@@H](C(=O)O)NC(=O)OC(C)(C)C)(F)F
InChIKey DHJLBUSFXBGSRT-JTQLQIEISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

The compound has a crystalline form and a molecular weight of approximately 433.12 g/mol. It is poor...

Compound Q&A

What industries use (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling (2S)-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)[2-(trifluoromethyl)phenyl]acetic acid (CAS: 1203454-45-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...