Compound Q&A

What industries use N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

Answer

N-Fmoc-L-Isoleucine methyl ester
N-Fmoc-L-Isoleucine methyl ester is primarily used in the pharmaceutical industry for peptide synthesis and as a building block in drug development. It is also utilized in polymer chemistry for the synthesis of biodegradable polymers and in the field of sensors for molecular recognition purposes.

About

English Name N-Fmoc-L-Isoleucine methyl ester
Molecular Formula C22H25NO4
Molecular Weight 367.4450000000001 g/mol
SMILES CCC(C)C(C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey IIDWGJXDOVAEEJ-XOBRGWDASA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

N-Fmoc-L-Isoleucine methyl ester is a white to off-white solid with a crystalline form. Its molecula...

Compound Q&A

How is N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3) typically synthesized?

N-Fmoc-L-Isoleucine methyl ester is typically synthesized through solid-phase peptide synthesis. The...

Compound Q&A

What precautions should be taken when handling N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

When handling N-Fmoc-L-Isoleucine methyl ester, wear appropriate personal protective equipment (PPE)...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...