Compound Q&A

How is N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3) typically synthesized?

Answer

N-Fmoc-L-Isoleucine methyl ester
N-Fmoc-L-Isoleucine methyl ester is typically synthesized through solid-phase peptide synthesis. The key steps involve coupling Fmoc-L-Isoleucine methyl ester to a solid support resin, which is then cleaved from the resin to form the final product. The reaction is catalyzed by various coupling agents and performed under mild conditions to ensure high yield and selectivity.

About

English Name N-Fmoc-L-Isoleucine methyl ester
Molecular Formula C22H25NO4
Molecular Weight 367.4450000000001 g/mol
SMILES CCC(C)C(C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey IIDWGJXDOVAEEJ-XOBRGWDASA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

N-Fmoc-L-Isoleucine methyl ester is a white to off-white solid with a crystalline form. Its molecula...

Compound Q&A

What industries use N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

N-Fmoc-L-Isoleucine methyl ester is primarily used in the pharmaceutical industry for peptide synthe...

Compound Q&A

What precautions should be taken when handling N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

When handling N-Fmoc-L-Isoleucine methyl ester, wear appropriate personal protective equipment (PPE)...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...