Compound Q&A

What are the physical and chemical properties of N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

Answer

N-Fmoc-L-Isoleucine methyl ester
N-Fmoc-L-Isoleucine methyl ester is a white to off-white solid with a crystalline form. Its molecular weight is approximately 379.4 g/mol. It is soluble in organic solvents like DMSO and methanol. Chemically, it is relatively stable under normal conditions but can react with strong bases. It has limited solubility in water.

About

English Name N-Fmoc-L-Isoleucine methyl ester
Molecular Formula C22H25NO4
Molecular Weight 367.4450000000001 g/mol
SMILES CCC(C)C(C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey IIDWGJXDOVAEEJ-XOBRGWDASA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3) typically synthesized?

N-Fmoc-L-Isoleucine methyl ester is typically synthesized through solid-phase peptide synthesis. The...

Compound Q&A

What industries use N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

N-Fmoc-L-Isoleucine methyl ester is primarily used in the pharmaceutical industry for peptide synthe...

Compound Q&A

What precautions should be taken when handling N-Fmoc-L-Isoleucine methyl ester (CAS: 148383-11-3)?

When handling N-Fmoc-L-Isoleucine methyl ester, wear appropriate personal protective equipment (PPE)...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...