Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl butyrate
When handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate, it is essential to wear appropriate personal protective equipment (PPE), including gloves, lab coat, and safety goggles. The compound should be stored in a sealed container in a fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbents, and the area should be ventilated. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl butyrate
Molecular Formula C12H11BrClNO2
Molecular Weight 316.58 g/mol
SMILES CCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey VZAORBVTZPOGMO-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

5-Bromo-6-chloro-1H-indol-3-yl butyrate is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl butyrate is typically synthesized via a multistep process involving t...

Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

5-Bromo-6-chloro-1H-indol-3-yl butyrate finds applications in the pharmaceutical industry for the de...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...