Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl butyrate
5-Bromo-6-chloro-1H-indol-3-yl butyrate is a crystalline solid with a molecular weight of approximately 358.03 g/mol. It has limited water solubility (0.01 g/L at 20°C) and exhibits moderate reactivity with certain nucleophiles. The compound is stable under normal conditions but should be stored away from moisture and extreme temperatures.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl butyrate
Molecular Formula C12H11BrClNO2
Molecular Weight 316.58 g/mol
SMILES CCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey VZAORBVTZPOGMO-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl butyrate is typically synthesized via a multistep process involving t...

Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

5-Bromo-6-chloro-1H-indol-3-yl butyrate finds applications in the pharmaceutical industry for the de...

Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

When handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...